C25H29ClN4O — CID 54280194
2-[2-[(2S)-1-[2-(3-chlorophenyl)acetyl]pyrrolidin-2-yl]ethyl]-1-ethylindole-6-carboximidamide (PubChem CID 54280194) has the molecular formula C25H29ClN4O and a molecular weight of 436.99 g/mol. Its IUPAC name is 2-[2-[(2S)-1-[2-(3-chlorophenyl)acetyl]pyrrolidin-2-yl]ethyl]-1-ethylindole-6-carboximidamide.
| Compound Name | 2-[2-[(2S)-1-[2-(3-chlorophenyl)acetyl]pyrrolidin-2-yl]ethyl]-1-ethylindole-6-carboximidamide |
|---|---|
| PubChem CID | 54280194 |
| Molecular Formula | C25H29ClN4O |
| Molecular Weight | 436.99 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | 2-[2-[(2S)-1-[2-(3-chlorophenyl)acetyl]pyrrolidin-2-yl]ethyl]-1-ethylindole-6-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc2cc(CC[C@@H]3CCCN3C(=O)Cc3cccc(Cl)c3)n(CC)c2c1 |
| InChI | InChI=1S/C25H29ClN4O/c1-2-29-22(15-18-8-9-19(25(27)28)16-23(18)29)11-10-21-7-4-12-30(21)24(31)14-17-5-3-6-20(26)13-17/h3,5-6,8-9,13,15-16,21H,2,4,7,10-12,14H2,1H3,(H3,27,28)/t21-/m0/s1 |
| InChIKey | RQGSOTGHZJKTAI-NRFANRHFSA-N |
| XLogP | 4.76 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.99 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|