C30H45N5O3 — CID 70107159
6-[(2R)-2-[(2S)-2-[2-(6-carbamimidoyl-1-ethylindol-2-yl)ethyl]pyrrolidine-1-carbonyl]pyrrolidin-1-yl]-2-ethylhexanoic acid (PubChem CID 70107159) has the molecular formula C30H45N5O3 and a molecular weight of 523.72 g/mol. Its IUPAC name is 6-[(2R)-2-[(2S)-2-[2-(6-carbamimidoyl-1-ethylindol-2-yl)ethyl]pyrrolidine-1-carbonyl]pyrrolidin-1-yl]-2-ethylhexanoic acid.
| Compound Name | 6-[(2R)-2-[(2S)-2-[2-(6-carbamimidoyl-1-ethylindol-2-yl)ethyl]pyrrolidine-1-carbonyl]pyrrolidin-1-yl]-2-ethylhexanoic acid |
|---|---|
| PubChem CID | 70107159 |
| Molecular Formula | C30H45N5O3 |
| Molecular Weight | 523.72 g/mol |
| Exact Mass | 523.35 |
| IUPAC Name | 6-[(2R)-2-[(2S)-2-[2-(6-carbamimidoyl-1-ethylindol-2-yl)ethyl]pyrrolidine-1-carbonyl]pyrrolidin-1-yl]-2-ethylhexanoic acid |
| SMILES | [H]/N=C(\N)c1ccc2cc(CC[C@@H]3CCCN3C(=O)[C@H]3CCCN3CCCCC(CC)C(=O)O)n(CC)c2c1 |
| InChI | InChI=1S/C30H45N5O3/c1-3-21(30(37)38)9-5-6-16-33-17-8-11-26(33)29(36)35-18-7-10-24(35)14-15-25-19-22-12-13-23(28(31)32)20-27(22)34(25)4-2/h12-13,19-21,24,26H,3-11,14-18H2,1-2H3,(H3,31,32)(H,37,38)/t21?,24-,26+/m0/s1 |
| InChIKey | WRMBLTKLWVCQOR-HRFJKEBLSA-N |
| XLogP | 4.61 |
| TPSA | 115.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.72 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|