C25H30N4O2 — CID 70106935
1-ethyl-2-[2-[(2S)-1-[2-(3-hydroxyphenyl)acetyl]pyrrolidin-2-yl]ethyl]indole-6-carboximidamide (PubChem CID 70106935) has the molecular formula C25H30N4O2 and a molecular weight of 418.54 g/mol. Its IUPAC name is 1-ethyl-2-[2-[(2S)-1-[2-(3-hydroxyphenyl)acetyl]pyrrolidin-2-yl]ethyl]indole-6-carboximidamide.
| Compound Name | 1-ethyl-2-[2-[(2S)-1-[2-(3-hydroxyphenyl)acetyl]pyrrolidin-2-yl]ethyl]indole-6-carboximidamide |
|---|---|
| PubChem CID | 70106935 |
| Molecular Formula | C25H30N4O2 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | 1-ethyl-2-[2-[(2S)-1-[2-(3-hydroxyphenyl)acetyl]pyrrolidin-2-yl]ethyl]indole-6-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc2cc(CC[C@@H]3CCCN3C(=O)Cc3cccc(O)c3)n(CC)c2c1 |
| InChI | InChI=1S/C25H30N4O2/c1-2-28-21(15-18-8-9-19(25(26)27)16-23(18)28)11-10-20-6-4-12-29(20)24(31)14-17-5-3-7-22(30)13-17/h3,5,7-9,13,15-16,20,30H,2,4,6,10-12,14H2,1H3,(H3,26,27)/t20-/m0/s1 |
| InChIKey | IUYBBFZAICCCJX-FQEVSTJZSA-N |
| XLogP | 3.82 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|