C28H40N6O4 — CID 21251235
ethyl 3-amino-4-[2-[2-[2-(6-carbamimidoyl-1-ethylindol-2-yl)ethyl]pyrrolidine-1-carbonyl]pyrrolidin-1-yl]-4-oxobutanoate (PubChem CID 21251235) has the molecular formula C28H40N6O4 and a molecular weight of 524.67 g/mol. Its IUPAC name is ethyl 3-amino-4-[2-[2-[2-(6-carbamimidoyl-1-ethylindol-2-yl)ethyl]pyrrolidine-1-carbonyl]pyrrolidin-1-yl]-4-oxobutanoate.
| Compound Name | ethyl 3-amino-4-[2-[2-[2-(6-carbamimidoyl-1-ethylindol-2-yl)ethyl]pyrrolidine-1-carbonyl]pyrrolidin-1-yl]-4-oxobutanoate |
|---|---|
| PubChem CID | 21251235 |
| Molecular Formula | C28H40N6O4 |
| Molecular Weight | 524.67 g/mol |
| Exact Mass | 524.31 |
| IUPAC Name | ethyl 3-amino-4-[2-[2-[2-(6-carbamimidoyl-1-ethylindol-2-yl)ethyl]pyrrolidine-1-carbonyl]pyrrolidin-1-yl]-4-oxobutanoate |
| SMILES | [H]/N=C(\N)c1ccc2cc(CCC3CCCN3C(=O)C3CCCN3C(=O)C(N)CC(=O)OCC)n(CC)c2c1 |
| InChI | InChI=1S/C28H40N6O4/c1-3-32-21(15-18-9-10-19(26(30)31)16-24(18)32)12-11-20-7-5-13-33(20)28(37)23-8-6-14-34(23)27(36)22(29)17-25(35)38-4-2/h9-10,15-16,20,22-23H,3-8,11-14,17,29H2,1-2H3,(H3,30,31) |
| InChIKey | ILWAMRMKSVGZCL-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 147.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.67 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|