C25H30N4O2 — CID 70109025
N-[[1-ethyl-2-[2-[(2S)-1-(2-phenylacetyl)pyrrolidin-2-yl]ethyl]indol-6-yl]methyl]nitrous amide (PubChem CID 70109025) has the molecular formula C25H30N4O2 and a molecular weight of 418.54 g/mol. Its IUPAC name is N-[[1-ethyl-2-[2-[(2S)-1-(2-phenylacetyl)pyrrolidin-2-yl]ethyl]indol-6-yl]methyl]nitrous amide.
| Compound Name | N-[[1-ethyl-2-[2-[(2S)-1-(2-phenylacetyl)pyrrolidin-2-yl]ethyl]indol-6-yl]methyl]nitrous amide |
|---|---|
| PubChem CID | 70109025 |
| Molecular Formula | C25H30N4O2 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | N-[[1-ethyl-2-[2-[(2S)-1-(2-phenylacetyl)pyrrolidin-2-yl]ethyl]indol-6-yl]methyl]nitrous amide |
| SMILES | CCn1c(CC[C@@H]2CCCN2C(=O)Cc2ccccc2)cc2ccc(CNN=O)cc21 |
| InChI | InChI=1S/C25H30N4O2/c1-2-28-23(17-21-11-10-20(15-24(21)28)18-26-27-31)13-12-22-9-6-14-29(22)25(30)16-19-7-4-3-5-8-19/h3-5,7-8,10-11,15,17,22H,2,6,9,12-14,16,18H2,1H3,(H,26,31)/t22-/m0/s1 |
| InChIKey | MMJNYOKKZKIUMT-QFIPXVFZSA-N |
| XLogP | 4.60 |
| TPSA | 66.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|