C31H30FN5O2Si — CID 70109523
3-[3-fluoro-4-[(2-methylimidazo[4,5-c]pyridin-1-yl)methyl]benzoyl]-N,N-dimethyl-4-(2-trimethylsilylethynyl)indole-1-carboxamide (PubChem CID 70109523) has the molecular formula C31H30FN5O2Si and a molecular weight of 551.70 g/mol. Its IUPAC name is 3-[3-fluoro-4-[(2-methylimidazo[4,5-c]pyridin-1-yl)methyl]benzoyl]-N,N-dimethyl-4-(2-trimethylsilylethynyl)indole-1-carboxamide.
| Compound Name | 3-[3-fluoro-4-[(2-methylimidazo[4,5-c]pyridin-1-yl)methyl]benzoyl]-N,N-dimethyl-4-(2-trimethylsilylethynyl)indole-1-carboxamide |
|---|---|
| PubChem CID | 70109523 |
| Molecular Formula | C31H30FN5O2Si |
| Molecular Weight | 551.70 g/mol |
| Exact Mass | 551.22 |
| IUPAC Name | 3-[3-fluoro-4-[(2-methylimidazo[4,5-c]pyridin-1-yl)methyl]benzoyl]-N,N-dimethyl-4-(2-trimethylsilylethynyl)indole-1-carboxamide |
| SMILES | Cc1nc2cnccc2n1Cc1ccc(C(=O)c2cn(C(=O)N(C)C)c3cccc(C#C[Si](C)(C)C)c23)cc1F |
| InChI | InChI=1S/C31H30FN5O2Si/c1-20-34-26-17-33-14-12-27(26)36(20)18-23-11-10-22(16-25(23)32)30(38)24-19-37(31(39)35(2)3)28-9-7-8-21(29(24)28)13-15-40(4,5)6/h7-12,14,16-17,19H,18H2,1-6H3 |
| InChIKey | OEHNLWKHKUEFTB-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 73.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.70 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|