C14H14F3NO4 — CID 70109536
methyl 4,4,4-trifluoro-3-[4-(2-methoxy-2-oxoethyl)anilino]but-2-enoate (PubChem CID 70109536) has the molecular formula C14H14F3NO4 and a molecular weight of 317.26 g/mol. Its IUPAC name is methyl 4,4,4-trifluoro-3-[4-(2-methoxy-2-oxoethyl)anilino]but-2-enoate.
| Compound Name | methyl 4,4,4-trifluoro-3-[4-(2-methoxy-2-oxoethyl)anilino]but-2-enoate |
|---|---|
| PubChem CID | 70109536 |
| Molecular Formula | C14H14F3NO4 |
| Molecular Weight | 317.26 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | methyl 4,4,4-trifluoro-3-[4-(2-methoxy-2-oxoethyl)anilino]but-2-enoate |
| SMILES | COC(=O)C=C(Nc1ccc(CC(=O)OC)cc1)C(F)(F)F |
| InChI | InChI=1S/C14H14F3NO4/c1-21-12(19)7-9-3-5-10(6-4-9)18-11(14(15,16)17)8-13(20)22-2/h3-6,8,18H,7H2,1-2H3 |
| InChIKey | KSKUHJXBSPUGHZ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.26 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|