C35H44FN5O2 — CID 70109748
N-[2-(4-fluorophenyl)-4-[4-[[1-(2-propoxyethyl)benzimidazol-2-yl]amino]piperidin-1-yl]butyl]-N-methylbenzamide (PubChem CID 70109748) has the molecular formula C35H44FN5O2 and a molecular weight of 585.77 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)-4-[4-[[1-(2-propoxyethyl)benzimidazol-2-yl]amino]piperidin-1-yl]butyl]-N-methylbenzamide.
| Compound Name | N-[2-(4-fluorophenyl)-4-[4-[[1-(2-propoxyethyl)benzimidazol-2-yl]amino]piperidin-1-yl]butyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 70109748 |
| Molecular Formula | C35H44FN5O2 |
| Molecular Weight | 585.77 g/mol |
| Exact Mass | 585.35 |
| IUPAC Name | N-[2-(4-fluorophenyl)-4-[4-[[1-(2-propoxyethyl)benzimidazol-2-yl]amino]piperidin-1-yl]butyl]-N-methylbenzamide |
| SMILES | CCCOCCn1c(NC2CCN(CCC(CN(C)C(=O)c3ccccc3)c3ccc(F)cc3)CC2)nc2ccccc21 |
| InChI | InChI=1S/C35H44FN5O2/c1-3-24-43-25-23-41-33-12-8-7-11-32(33)38-35(41)37-31-18-21-40(22-19-31)20-17-29(27-13-15-30(36)16-14-27)26-39(2)34(42)28-9-5-4-6-10-28/h4-16,29,31H,3,17-26H2,1-2H3,(H,37,38) |
| InChIKey | BINLZZRELHASOF-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 62.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.77 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|