C38H47N5O4 — CID 70109569
N-[2-(2-benzyl-1,3-dioxol-4-yl)-4-[4-[[1-(2-ethoxyethyl)benzimidazol-2-yl]amino]piperidin-1-yl]butyl]-N-methylbenzamide (PubChem CID 70109569) has the molecular formula C38H47N5O4 and a molecular weight of 637.83 g/mol. Its IUPAC name is N-[2-(2-benzyl-1,3-dioxol-4-yl)-4-[4-[[1-(2-ethoxyethyl)benzimidazol-2-yl]amino]piperidin-1-yl]butyl]-N-methylbenzamide.
| Compound Name | N-[2-(2-benzyl-1,3-dioxol-4-yl)-4-[4-[[1-(2-ethoxyethyl)benzimidazol-2-yl]amino]piperidin-1-yl]butyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 70109569 |
| Molecular Formula | C38H47N5O4 |
| Molecular Weight | 637.83 g/mol |
| Exact Mass | 637.36 |
| IUPAC Name | N-[2-(2-benzyl-1,3-dioxol-4-yl)-4-[4-[[1-(2-ethoxyethyl)benzimidazol-2-yl]amino]piperidin-1-yl]butyl]-N-methylbenzamide |
| SMILES | CCOCCn1c(NC2CCN(CCC(CN(C)C(=O)c3ccccc3)C3=COC(Cc4ccccc4)O3)CC2)nc2ccccc21 |
| InChI | InChI=1S/C38H47N5O4/c1-3-45-25-24-43-34-17-11-10-16-33(34)40-38(43)39-32-19-22-42(23-20-32)21-18-31(27-41(2)37(44)30-14-8-5-9-15-30)35-28-46-36(47-35)26-29-12-6-4-7-13-29/h4-17,28,31-32,36H,3,18-27H2,1-2H3,(H,39,40) |
| InChIKey | QXWYQRFUKQFAFG-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 81.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.83 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|