C33H42N6O2 — CID 67591173
N-[4-[4-[[4-(2-ethoxyethyl)-1H-benzimidazol-2-yl]amino]piperidin-1-yl]-2-pyridin-4-ylbutyl]-N-methylbenzamide (PubChem CID 67591173) has the molecular formula C33H42N6O2 and a molecular weight of 554.74 g/mol. Its IUPAC name is N-[4-[4-[[4-(2-ethoxyethyl)-1H-benzimidazol-2-yl]amino]piperidin-1-yl]-2-pyridin-4-ylbutyl]-N-methylbenzamide.
| Compound Name | N-[4-[4-[[4-(2-ethoxyethyl)-1H-benzimidazol-2-yl]amino]piperidin-1-yl]-2-pyridin-4-ylbutyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 67591173 |
| Molecular Formula | C33H42N6O2 |
| Molecular Weight | 554.74 g/mol |
| Exact Mass | 554.34 |
| IUPAC Name | N-[4-[4-[[4-(2-ethoxyethyl)-1H-benzimidazol-2-yl]amino]piperidin-1-yl]-2-pyridin-4-ylbutyl]-N-methylbenzamide |
| SMILES | CCOCCc1cccc2[nH]c(NC3CCN(CCC(CN(C)C(=O)c4ccccc4)c4ccncc4)CC3)nc12 |
| InChI | InChI=1S/C33H42N6O2/c1-3-41-23-17-26-10-7-11-30-31(26)37-33(36-30)35-29-15-21-39(22-16-29)20-14-28(25-12-18-34-19-13-25)24-38(2)32(40)27-8-5-4-6-9-27/h4-13,18-19,28-29H,3,14-17,20-24H2,1-2H3,(H2,35,36,37) |
| InChIKey | MLHJUMLMYLCGAV-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 86.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.74 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|