C34H41N5O2 — CID 67589534
N-[2-(4-methoxyphenyl)-4-[4-[(4-prop-2-enyl-1H-benzimidazol-2-yl)amino]piperidin-1-yl]butyl]-N-methylbenzamide (PubChem CID 67589534) has the molecular formula C34H41N5O2 and a molecular weight of 551.74 g/mol. Its IUPAC name is N-[2-(4-methoxyphenyl)-4-[4-[(4-prop-2-enyl-1H-benzimidazol-2-yl)amino]piperidin-1-yl]butyl]-N-methylbenzamide.
| Compound Name | N-[2-(4-methoxyphenyl)-4-[4-[(4-prop-2-enyl-1H-benzimidazol-2-yl)amino]piperidin-1-yl]butyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 67589534 |
| Molecular Formula | C34H41N5O2 |
| Molecular Weight | 551.74 g/mol |
| Exact Mass | 551.33 |
| IUPAC Name | N-[2-(4-methoxyphenyl)-4-[4-[(4-prop-2-enyl-1H-benzimidazol-2-yl)amino]piperidin-1-yl]butyl]-N-methylbenzamide |
| SMILES | C=CCc1cccc2[nH]c(NC3CCN(CCC(CN(C)C(=O)c4ccccc4)c4ccc(OC)cc4)CC3)nc12 |
| InChI | InChI=1S/C34H41N5O2/c1-4-9-26-12-8-13-31-32(26)37-34(36-31)35-29-19-22-39(23-20-29)21-18-28(25-14-16-30(41-3)17-15-25)24-38(2)33(40)27-10-6-5-7-11-27/h4-8,10-17,28-29H,1,9,18-24H2,2-3H3,(H2,35,36,37) |
| InChIKey | ZAAHXYALZPDXSF-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 73.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.74 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|