C33H37Cl2N5O — CID 67591286
N-[2-(3,4-dichlorophenyl)-1-[4-[(4-prop-2-enyl-1H-benzimidazol-2-yl)amino]piperidin-1-yl]butyl]-N-methylbenzamide (PubChem CID 67591286) has the molecular formula C33H37Cl2N5O and a molecular weight of 590.60 g/mol. Its IUPAC name is N-[2-(3,4-dichlorophenyl)-1-[4-[(4-prop-2-enyl-1H-benzimidazol-2-yl)amino]piperidin-1-yl]butyl]-N-methylbenzamide.
| Compound Name | N-[2-(3,4-dichlorophenyl)-1-[4-[(4-prop-2-enyl-1H-benzimidazol-2-yl)amino]piperidin-1-yl]butyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 67591286 |
| Molecular Formula | C33H37Cl2N5O |
| Molecular Weight | 590.60 g/mol |
| Exact Mass | 589.24 |
| IUPAC Name | N-[2-(3,4-dichlorophenyl)-1-[4-[(4-prop-2-enyl-1H-benzimidazol-2-yl)amino]piperidin-1-yl]butyl]-N-methylbenzamide |
| SMILES | C=CCc1cccc2[nH]c(NC3CCN(C(C(CC)c4ccc(Cl)c(Cl)c4)N(C)C(=O)c4ccccc4)CC3)nc12 |
| InChI | InChI=1S/C33H37Cl2N5O/c1-4-10-22-13-9-14-29-30(22)38-33(37-29)36-25-17-19-40(20-18-25)31(39(3)32(41)23-11-7-6-8-12-23)26(5-2)24-15-16-27(34)28(35)21-24/h4,6-9,11-16,21,25-26,31H,1,5,10,17-20H2,2-3H3,(H2,36,37,38) |
| InChIKey | RLUBJVFEGIHFDH-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 64.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.60 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|