C28H37Cl2N5O — CID 142635220
N-[1-[2-[3-(3,4-dichlorophenyl)pyrrolidin-1-yl]ethyl]piperidin-4-yl]-1-(2-ethoxyethyl)benzimidazol-2-amine (PubChem CID 142635220) has the molecular formula C28H37Cl2N5O and a molecular weight of 530.54 g/mol. Its IUPAC name is N-[1-[2-[3-(3,4-dichlorophenyl)pyrrolidin-1-yl]ethyl]piperidin-4-yl]-1-(2-ethoxyethyl)benzimidazol-2-amine.
| Compound Name | N-[1-[2-[3-(3,4-dichlorophenyl)pyrrolidin-1-yl]ethyl]piperidin-4-yl]-1-(2-ethoxyethyl)benzimidazol-2-amine |
|---|---|
| PubChem CID | 142635220 |
| Molecular Formula | C28H37Cl2N5O |
| Molecular Weight | 530.54 g/mol |
| Exact Mass | 529.24 |
| IUPAC Name | N-[1-[2-[3-(3,4-dichlorophenyl)pyrrolidin-1-yl]ethyl]piperidin-4-yl]-1-(2-ethoxyethyl)benzimidazol-2-amine |
| SMILES | CCOCCn1c(NC2CCN(CCN3CCC(c4ccc(Cl)c(Cl)c4)C3)CC2)nc2ccccc21 |
| InChI | InChI=1S/C28H37Cl2N5O/c1-2-36-18-17-35-27-6-4-3-5-26(27)32-28(35)31-23-10-13-33(14-11-23)15-16-34-12-9-22(20-34)21-7-8-24(29)25(30)19-21/h3-8,19,22-23H,2,9-18,20H2,1H3,(H,31,32) |
| InChIKey | HTHIEQMAMZYKFF-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 45.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.54 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|