C24H27FN4O3S — CID 70112392
1-(benzenesulfonamido)-1-[3-(dimethylamino)propyl]-3-[4-(2-fluorophenyl)phenyl]urea (PubChem CID 70112392) has the molecular formula C24H27FN4O3S and a molecular weight of 470.57 g/mol. Its IUPAC name is 1-(benzenesulfonamido)-1-[3-(dimethylamino)propyl]-3-[4-(2-fluorophenyl)phenyl]urea.
| Compound Name | 1-(benzenesulfonamido)-1-[3-(dimethylamino)propyl]-3-[4-(2-fluorophenyl)phenyl]urea |
|---|---|
| PubChem CID | 70112392 |
| Molecular Formula | C24H27FN4O3S |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | 1-(benzenesulfonamido)-1-[3-(dimethylamino)propyl]-3-[4-(2-fluorophenyl)phenyl]urea |
| SMILES | CN(C)CCCN(NS(=O)(=O)c1ccccc1)C(=O)Nc1ccc(-c2ccccc2F)cc1 |
| InChI | InChI=1S/C24H27FN4O3S/c1-28(2)17-8-18-29(27-33(31,32)21-9-4-3-5-10-21)24(30)26-20-15-13-19(14-16-20)22-11-6-7-12-23(22)25/h3-7,9-16,27H,8,17-18H2,1-2H3,(H,26,30) |
| InChIKey | ZZXVDRFCVNBISY-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|