C30H25N5O3 — CID 70113887
2-[4-[3-(9-oxo-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-2-yl)indol-1-yl]butyl]isoindole-1,3-dione (PubChem CID 70113887) has the molecular formula C30H25N5O3 and a molecular weight of 503.56 g/mol. Its IUPAC name is 2-[4-[3-(9-oxo-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-2-yl)indol-1-yl]butyl]isoindole-1,3-dione.
| Compound Name | 2-[4-[3-(9-oxo-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-2-yl)indol-1-yl]butyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 70113887 |
| Molecular Formula | C30H25N5O3 |
| Molecular Weight | 503.56 g/mol |
| Exact Mass | 503.20 |
| IUPAC Name | 2-[4-[3-(9-oxo-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-2-yl)indol-1-yl]butyl]isoindole-1,3-dione |
| SMILES | O=C1NCCn2c(-c3cn(CCCCN4C(=O)c5ccccc5C4=O)c4ccccc34)nc3cccc1c32 |
| InChI | InChI=1S/C30H25N5O3/c36-28-22-11-7-12-24-26(22)34(17-14-31-28)27(32-24)23-18-33(25-13-4-3-8-19(23)25)15-5-6-16-35-29(37)20-9-1-2-10-21(20)30(35)38/h1-4,7-13,18H,5-6,14-17H2,(H,31,36) |
| InChIKey | YDBQDWWOFKCZRD-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 89.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.56 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|