C27H29N3O — CID 70114245
7-methoxy-3-(5-phenyl-3-pyridinyl)-2-(1-piperidin-3-ylethyl)-1H-indole (PubChem CID 70114245) has the molecular formula C27H29N3O and a molecular weight of 411.55 g/mol. Its IUPAC name is 7-methoxy-3-(5-phenyl-3-pyridinyl)-2-(1-piperidin-3-ylethyl)-1H-indole.
| Compound Name | 7-methoxy-3-(5-phenyl-3-pyridinyl)-2-(1-piperidin-3-ylethyl)-1H-indole |
|---|---|
| PubChem CID | 70114245 |
| Molecular Formula | C27H29N3O |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.23 |
| IUPAC Name | 7-methoxy-3-(5-phenyl-3-pyridinyl)-2-(1-piperidin-3-ylethyl)-1H-indole |
| SMILES | COc1cccc2c(-c3cncc(-c4ccccc4)c3)c(C(C)C3CCCNC3)[nH]c12 |
| InChI | InChI=1S/C27H29N3O/c1-18(20-10-7-13-28-15-20)26-25(23-11-6-12-24(31-2)27(23)30-26)22-14-21(16-29-17-22)19-8-4-3-5-9-19/h3-6,8-9,11-12,14,16-18,20,28,30H,7,10,13,15H2,1-2H3 |
| InChIKey | YWDBFMKWBRIXHP-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |