C16H14BrF2NO4 — CID 70114274
ethyl 7-bromo-6-cyclopropyl-8-(difluoromethoxy)-4-oxo-1H-quinoline-3-carboxylate (PubChem CID 70114274) has the molecular formula C16H14BrF2NO4 and a molecular weight of 402.19 g/mol. Its IUPAC name is ethyl 7-bromo-6-cyclopropyl-8-(difluoromethoxy)-4-oxo-1H-quinoline-3-carboxylate.
| Compound Name | ethyl 7-bromo-6-cyclopropyl-8-(difluoromethoxy)-4-oxo-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 70114274 |
| Molecular Formula | C16H14BrF2NO4 |
| Molecular Weight | 402.19 g/mol |
| Exact Mass | 401.01 |
| IUPAC Name | ethyl 7-bromo-6-cyclopropyl-8-(difluoromethoxy)-4-oxo-1H-quinoline-3-carboxylate |
| SMILES | CCOC(=O)c1c[nH]c2c(OC(F)F)c(Br)c(C3CC3)cc2c1=O |
| InChI | InChI=1S/C16H14BrF2NO4/c1-2-23-15(22)10-6-20-12-9(13(10)21)5-8(7-3-4-7)11(17)14(12)24-16(18)19/h5-7,16H,2-4H2,1H3,(H,20,21) |
| InChIKey | ZMAQBLJAHGROHQ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 68.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.19 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |