C20H23N7O2S — CID 70114449
2-[[1-[2-(ethylsulfonylamino)ethyl]benzimidazol-2-yl]methyl]-3H-benzimidazole-5-carboximidamide (PubChem CID 70114449) has the molecular formula C20H23N7O2S and a molecular weight of 425.52 g/mol. Its IUPAC name is 2-[[1-[2-(ethylsulfonylamino)ethyl]benzimidazol-2-yl]methyl]-3H-benzimidazole-5-carboximidamide.
| Compound Name | 2-[[1-[2-(ethylsulfonylamino)ethyl]benzimidazol-2-yl]methyl]-3H-benzimidazole-5-carboximidamide |
|---|---|
| PubChem CID | 70114449 |
| Molecular Formula | C20H23N7O2S |
| Molecular Weight | 425.52 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | 2-[[1-[2-(ethylsulfonylamino)ethyl]benzimidazol-2-yl]methyl]-3H-benzimidazole-5-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc2nc(Cc3nc4ccccc4n3CCNS(=O)(=O)CC)[nH]c2c1 |
| InChI | InChI=1S/C20H23N7O2S/c1-2-30(28,29)23-9-10-27-17-6-4-3-5-15(17)26-19(27)12-18-24-14-8-7-13(20(21)22)11-16(14)25-18/h3-8,11,23H,2,9-10,12H2,1H3,(H3,21,22)(H,24,25) |
| InChIKey | TXAPTEQSSGZBLB-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 142.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.52 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|