C11H20N2O — CID 70114480
N-cyclohexyl-N-ethyl-4,5-dihydro-1,3-oxazol-2-amine (PubChem CID 70114480) has the molecular formula C11H20N2O and a molecular weight of 196.29 g/mol. Its IUPAC name is N-cyclohexyl-N-ethyl-4,5-dihydro-1,3-oxazol-2-amine.
| Compound Name | N-cyclohexyl-N-ethyl-4,5-dihydro-1,3-oxazol-2-amine |
|---|---|
| PubChem CID | 70114480 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | N-cyclohexyl-N-ethyl-4,5-dihydro-1,3-oxazol-2-amine |
| SMILES | CCN(C1=NCCO1)C1CCCCC1 |
| InChI | InChI=1S/C11H20N2O/c1-2-13(11-12-8-9-14-11)10-6-4-3-5-7-10/h10H,2-9H2,1H3 |
| InChIKey | GBSQGBLQZDCMDP-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |