C26H37N3O2 — CID 70118988
N,N-diethyl-4-[3-methoxy-N-(1-pyrrolidin-1-ylbutyl)anilino]benzamide (PubChem CID 70118988) has the molecular formula C26H37N3O2 and a molecular weight of 423.60 g/mol. Its IUPAC name is N,N-diethyl-4-[3-methoxy-N-(1-pyrrolidin-1-ylbutyl)anilino]benzamide.
| Compound Name | N,N-diethyl-4-[3-methoxy-N-(1-pyrrolidin-1-ylbutyl)anilino]benzamide |
|---|---|
| PubChem CID | 70118988 |
| Molecular Formula | C26H37N3O2 |
| Molecular Weight | 423.60 g/mol |
| Exact Mass | 423.29 |
| IUPAC Name | N,N-diethyl-4-[3-methoxy-N-(1-pyrrolidin-1-ylbutyl)anilino]benzamide |
| SMILES | CCCC(N1CCCC1)N(c1ccc(C(=O)N(CC)CC)cc1)c1cccc(OC)c1 |
| InChI | InChI=1S/C26H37N3O2/c1-5-11-25(28-18-8-9-19-28)29(23-12-10-13-24(20-23)31-4)22-16-14-21(15-17-22)26(30)27(6-2)7-3/h10,12-17,20,25H,5-9,11,18-19H2,1-4H3 |
| InChIKey | IRYACWKAJQTMAB-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.60 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |