C25H28N2OS2 — CID 70120021
1-[(5-ethoxy-1,3-benzothiazol-2-yl)sulfanyl]-N-[(1R)-1-naphthalen-1-ylethyl]butan-1-amine (PubChem CID 70120021) has the molecular formula C25H28N2OS2 and a molecular weight of 436.65 g/mol. Its IUPAC name is 1-[(5-ethoxy-1,3-benzothiazol-2-yl)sulfanyl]-N-[(1R)-1-naphthalen-1-ylethyl]butan-1-amine.
| Compound Name | 1-[(5-ethoxy-1,3-benzothiazol-2-yl)sulfanyl]-N-[(1R)-1-naphthalen-1-ylethyl]butan-1-amine |
|---|---|
| PubChem CID | 70120021 |
| Molecular Formula | C25H28N2OS2 |
| Molecular Weight | 436.65 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | 1-[(5-ethoxy-1,3-benzothiazol-2-yl)sulfanyl]-N-[(1R)-1-naphthalen-1-ylethyl]butan-1-amine |
| SMILES | CCCC(N[C@H](C)c1cccc2ccccc12)Sc1nc2cc(OCC)ccc2s1 |
| InChI | InChI=1S/C25H28N2OS2/c1-4-9-24(26-17(3)20-13-8-11-18-10-6-7-12-21(18)20)30-25-27-22-16-19(28-5-2)14-15-23(22)29-25/h6-8,10-17,24,26H,4-5,9H2,1-3H3/t17-,24?/m1/s1 |
| InChIKey | GGAKMLPWGQQXMY-BPNWFJGMSA-N |
| XLogP | 7.42 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.65 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|