C23H20FN3O5 — CID 70121147
N-[[(5S)-3-[4-[(1-acetyl-2-oxoindol-3-ylidene)methyl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide (PubChem CID 70121147) has the molecular formula C23H20FN3O5 and a molecular weight of 437.43 g/mol. Its IUPAC name is N-[[(5S)-3-[4-[(1-acetyl-2-oxoindol-3-ylidene)methyl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide.
| Compound Name | N-[[(5S)-3-[4-[(1-acetyl-2-oxoindol-3-ylidene)methyl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 70121147 |
| Molecular Formula | C23H20FN3O5 |
| Molecular Weight | 437.43 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | N-[[(5S)-3-[4-[(1-acetyl-2-oxoindol-3-ylidene)methyl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
| SMILES | CC(=O)NC[C@H]1CN(c2ccc(C=C3C(=O)N(C(C)=O)c4ccccc43)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C23H20FN3O5/c1-13(28)25-11-17-12-26(23(31)32-17)16-8-7-15(20(24)10-16)9-19-18-5-3-4-6-21(18)27(14(2)29)22(19)30/h3-10,17H,11-12H2,1-2H3,(H,25,28)/t17-/m0/s1 |
| InChIKey | BDACSIRTWNFZCH-KRWDZBQOSA-N |
| XLogP | 2.72 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.43 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|