C14H9N5O5 — CID 7012371
(8R)-6-amino-8-(3-nitrophenyl)-2,4-dioxo-1,8-dihydropyrano[3,2-d]pyrimidine-7-carbonitrile (PubChem CID 7012371) has the molecular formula C14H9N5O5 and a molecular weight of 327.26 g/mol. Its IUPAC name is (8R)-6-amino-8-(3-nitrophenyl)-2,4-dioxo-1,8-dihydropyrano[3,2-d]pyrimidine-7-carbonitrile.
| Compound Name | (8R)-6-amino-8-(3-nitrophenyl)-2,4-dioxo-1,8-dihydropyrano[3,2-d]pyrimidine-7-carbonitrile |
|---|---|
| PubChem CID | 7012371 |
| Molecular Formula | C14H9N5O5 |
| Molecular Weight | 327.26 g/mol |
| Exact Mass | 327.06 |
| IUPAC Name | (8R)-6-amino-8-(3-nitrophenyl)-2,4-dioxo-1,8-dihydropyrano[3,2-d]pyrimidine-7-carbonitrile |
| SMILES | N#CC1=C(N)Oc2c([nH]c(=O)[nH]c2=O)[C@@H]1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H9N5O5/c15-5-8-9(6-2-1-3-7(4-6)19(22)23)10-11(24-12(8)16)13(20)18-14(21)17-10/h1-4,9H,16H2,(H2,17,18,20,21)/t9-/m1/s1 |
| InChIKey | MBXYIKSSCXKSJN-SECBINFHSA-N |
| XLogP | 0.19 |
| TPSA | 167.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.26 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|