C23H14N4O4 — CID 155519319
4-amino-6-(4-nitrophenyl)-8-oxo-3-oxa-9-azatetracyclo[8.8.0.02,7.011,16]octadeca-1(10),2(7),4,11,13,15,17-heptaene-5-carbonitrile (PubChem CID 155519319) has the molecular formula C23H14N4O4 and a molecular weight of 410.39 g/mol. Its IUPAC name is 4-amino-6-(4-nitrophenyl)-8-oxo-3-oxa-9-azatetracyclo[8.8.0.02,7.011,16]octadeca-1(10),2(7),4,11,13,15,17-heptaene-5-carbonitrile.
| Compound Name | 4-amino-6-(4-nitrophenyl)-8-oxo-3-oxa-9-azatetracyclo[8.8.0.02,7.011,16]octadeca-1(10),2(7),4,11,13,15,17-heptaene-5-carbonitrile |
|---|---|
| PubChem CID | 155519319 |
| Molecular Formula | C23H14N4O4 |
| Molecular Weight | 410.39 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | 4-amino-6-(4-nitrophenyl)-8-oxo-3-oxa-9-azatetracyclo[8.8.0.02,7.011,16]octadeca-1(10),2(7),4,11,13,15,17-heptaene-5-carbonitrile |
| SMILES | N#CC1=C(N)Oc2c(c(=O)[nH]c3c2ccc2ccccc23)C1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H14N4O4/c24-11-17-18(13-5-8-14(9-6-13)27(29)30)19-21(31-22(17)25)16-10-7-12-3-1-2-4-15(12)20(16)26-23(19)28/h1-10,18H,25H2,(H,26,28) |
| InChIKey | PMURDSMZDQYYJA-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 135.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.39 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|