C25H38FN5O5 — CID 70126933
tert-butyl 2-amino-2-[1-[4-[amino-[(2-methylpropan-2-yl)oxycarbonyl]carbamoyl]-5-(cyclopropylamino)-2-fluorophenyl]pyrrolidin-3-yl]acetate (PubChem CID 70126933) has the molecular formula C25H38FN5O5 and a molecular weight of 507.61 g/mol. Its IUPAC name is tert-butyl 2-amino-2-[1-[4-[amino-[(2-methylpropan-2-yl)oxycarbonyl]carbamoyl]-5-(cyclopropylamino)-2-fluorophenyl]pyrrolidin-3-yl]acetate.
| Compound Name | tert-butyl 2-amino-2-[1-[4-[amino-[(2-methylpropan-2-yl)oxycarbonyl]carbamoyl]-5-(cyclopropylamino)-2-fluorophenyl]pyrrolidin-3-yl]acetate |
|---|---|
| PubChem CID | 70126933 |
| Molecular Formula | C25H38FN5O5 |
| Molecular Weight | 507.61 g/mol |
| Exact Mass | 507.29 |
| IUPAC Name | tert-butyl 2-amino-2-[1-[4-[amino-[(2-methylpropan-2-yl)oxycarbonyl]carbamoyl]-5-(cyclopropylamino)-2-fluorophenyl]pyrrolidin-3-yl]acetate |
| SMILES | CC(C)(C)OC(=O)C(N)C1CCN(c2cc(NC3CC3)c(C(=O)N(N)C(=O)OC(C)(C)C)cc2F)C1 |
| InChI | InChI=1S/C25H38FN5O5/c1-24(2,3)35-22(33)20(27)14-9-10-30(13-14)19-12-18(29-15-7-8-15)16(11-17(19)26)21(32)31(28)23(34)36-25(4,5)6/h11-12,14-15,20,29H,7-10,13,27-28H2,1-6H3 |
| InChIKey | XTGDUILVYWKVMY-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 140.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.61 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|