C15H27N5O2 — CID 135742105
tert-butyl 2-amino-2-[(3S)-1-(4-amino-1-methylpyrazol-5-yl)piperidin-3-yl]acetate (PubChem CID 135742105) has the molecular formula C15H27N5O2 and a molecular weight of 309.41 g/mol. Its IUPAC name is tert-butyl 2-amino-2-[(3S)-1-(4-amino-1-methylpyrazol-5-yl)piperidin-3-yl]acetate.
| Compound Name | tert-butyl 2-amino-2-[(3S)-1-(4-amino-1-methylpyrazol-5-yl)piperidin-3-yl]acetate |
|---|---|
| PubChem CID | 135742105 |
| Molecular Formula | C15H27N5O2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.22 |
| IUPAC Name | tert-butyl 2-amino-2-[(3S)-1-(4-amino-1-methylpyrazol-5-yl)piperidin-3-yl]acetate |
| SMILES | Cn1ncc(N)c1N1CCC[C@H](C(N)C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C15H27N5O2/c1-15(2,3)22-14(21)12(17)10-6-5-7-20(9-10)13-11(16)8-18-19(13)4/h8,10,12H,5-7,9,16-17H2,1-4H3/t10-,12?/m0/s1 |
| InChIKey | KTIDKQDSNTWJLT-NUHJPDEHSA-N |
| XLogP | 0.89 |
| TPSA | 99.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |