About cyclohexane-1,4-diamine;ethane-1,2-diamine
cyclohexane-1,4-diamine;ethane-1,2-diamine (PubChem CID 70127275) has the molecular formula C8H22N4
and a molecular weight of 174.29 g/mol. Its IUPAC name is cyclohexane-1,4-diamine;ethane-1,2-diamine.
Molecular Properties
| Compound Name | cyclohexane-1,4-diamine;ethane-1,2-diamine |
| PubChem CID | 70127275 |
| Molecular Formula | C8H22N4 |
| Molecular Weight | 174.29 g/mol |
| Exact Mass | 174.18 |
| IUPAC Name | cyclohexane-1,4-diamine;ethane-1,2-diamine |
| SMILES | NC1CCC(N)CC1.NCCN |
| InChI | InChI=1S/C6H14N2.C2H8N2/c7-5-1-2-6(8)4-3-5;3-1-2-4/h5-6H,1-4,7-8H2;1-4H2 |
| InChIKey | JWPQRNFVXWCCSR-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.29 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze cyclohexane-1,4-diamine;ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexane-1,4-diamine;ethane-1,2-diamine?
The IUPAC name of cyclohexane-1,4-diamine;ethane-1,2-diamine (CID 70127275) is cyclohexane-1,4-diamine;ethane-1,2-diamine.
What is the SMILES notation for cyclohexane-1,4-diamine;ethane-1,2-diamine?
The canonical SMILES for cyclohexane-1,4-diamine;ethane-1,2-diamine is NC1CCC(N)CC1.NCCN.
What is the InChIKey of cyclohexane-1,4-diamine;ethane-1,2-diamine?
The InChIKey is JWPQRNFVXWCCSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N2.C2H8N2/c7-5-1-2-6(8)4-3-5;3-1-2-4/h5-6H,1-4,7-8H2;1-4H2.
What are the key properties of cyclohexane-1,4-diamine;ethane-1,2-diamine?
cyclohexane-1,4-diamine;ethane-1,2-diamine has a molecular weight of 174.29 g/mol, XLogP of -0.88, 1 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexane-1,4-diamine;ethane-1,2-diamine is sourced from PubChem (CID 70127275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).