C8H22N4 — CID 70127275
cyclohexane-1,4-diamine;ethane-1,2-diamine (PubChem CID 70127275) has the molecular formula C8H22N4 and a molecular weight of 174.29 g/mol. Its IUPAC name is cyclohexane-1,4-diamine;ethane-1,2-diamine.
| Compound Name | cyclohexane-1,4-diamine;ethane-1,2-diamine |
|---|---|
| PubChem CID | 70127275 |
| Molecular Formula | C8H22N4 |
| Molecular Weight | 174.29 g/mol |
| Exact Mass | 174.18 |
| IUPAC Name | cyclohexane-1,4-diamine;ethane-1,2-diamine |
| SMILES | NC1CCC(N)CC1.NCCN |
| InChI | InChI=1S/C6H14N2.C2H8N2/c7-5-1-2-6(8)4-3-5;3-1-2-4/h5-6H,1-4,7-8H2;1-4H2 |
| InChIKey | JWPQRNFVXWCCSR-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.29 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |