C9H17NO4 — CID 7012966
3-[[(3S,4R)-4-hydroxy-4-methyloxan-3-yl]azaniumyl]propanoate (PubChem CID 7012966) has the molecular formula C9H17NO4 and a molecular weight of 203.24 g/mol. Its IUPAC name is 3-[[(3S,4R)-4-hydroxy-4-methyloxan-3-yl]azaniumyl]propanoate.
| Compound Name | 3-[[(3S,4R)-4-hydroxy-4-methyloxan-3-yl]azaniumyl]propanoate |
|---|---|
| PubChem CID | 7012966 |
| Molecular Formula | C9H17NO4 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.12 |
| IUPAC Name | 3-[[(3S,4R)-4-hydroxy-4-methyloxan-3-yl]azaniumyl]propanoate |
| SMILES | C[C@@]1(O)CCOC[C@@H]1[NH2+]CCC(=O)[O-] |
| InChI | InChI=1S/C9H17NO4/c1-9(13)3-5-14-6-7(9)10-4-2-8(11)12/h7,10,13H,2-6H2,1H3,(H,11,12)/t7-,9+/m0/s1 |
| InChIKey | UZBZICLVTOAFGB-IONNQARKSA-N |
| XLogP | -2.77 |
| TPSA | 86.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | -2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |