C18H12F3IN4O2 — CID 70130305
2-[1-iodo-1-(4,6,7-trifluoro-1H-benzimidazol-2-yl)ethyl]-3-methylbenzimidazole-5-carboxylic acid (PubChem CID 70130305) has the molecular formula C18H12F3IN4O2 and a molecular weight of 500.22 g/mol. Its IUPAC name is 2-[1-iodo-1-(4,6,7-trifluoro-1H-benzimidazol-2-yl)ethyl]-3-methylbenzimidazole-5-carboxylic acid.
| Compound Name | 2-[1-iodo-1-(4,6,7-trifluoro-1H-benzimidazol-2-yl)ethyl]-3-methylbenzimidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 70130305 |
| Molecular Formula | C18H12F3IN4O2 |
| Molecular Weight | 500.22 g/mol |
| Exact Mass | 500.00 |
| IUPAC Name | 2-[1-iodo-1-(4,6,7-trifluoro-1H-benzimidazol-2-yl)ethyl]-3-methylbenzimidazole-5-carboxylic acid |
| SMILES | Cn1c(C(C)(I)c2nc3c(F)cc(F)c(F)c3[nH]2)nc2ccc(C(=O)O)cc21 |
| InChI | InChI=1S/C18H12F3IN4O2/c1-18(22,16-24-13-9(20)6-8(19)12(21)14(13)25-16)17-23-10-4-3-7(15(27)28)5-11(10)26(17)2/h3-6H,1-2H3,(H,24,25)(H,27,28) |
| InChIKey | YCRWDNGALJAESP-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.22 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|