C24H24FNO3S — CID 7013130
(3E,4S,7S)-4-(4-fluorophenyl)-3-[hydroxy(propoxy)methylidene]-2-methylidene-7-thiophen-2-yl-4a,6,7,8-tetrahydro-4H-quinolin-5-one (PubChem CID 7013130) has the molecular formula C24H24FNO3S and a molecular weight of 425.53 g/mol. Its IUPAC name is (3E,4S,7S)-4-(4-fluorophenyl)-3-[hydroxy(propoxy)methylidene]-2-methylidene-7-thiophen-2-yl-4a,6,7,8-tetrahydro-4H-quinolin-5-one.
| Compound Name | (3E,4S,7S)-4-(4-fluorophenyl)-3-[hydroxy(propoxy)methylidene]-2-methylidene-7-thiophen-2-yl-4a,6,7,8-tetrahydro-4H-quinolin-5-one |
|---|---|
| PubChem CID | 7013130 |
| Molecular Formula | C24H24FNO3S |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | (3E,4S,7S)-4-(4-fluorophenyl)-3-[hydroxy(propoxy)methylidene]-2-methylidene-7-thiophen-2-yl-4a,6,7,8-tetrahydro-4H-quinolin-5-one |
| SMILES | C=C1N=C2C[C@H](c3cccs3)CC(=O)C2[C@@H](c2ccc(F)cc2)/C1=C(/O)OCCC |
| InChI | InChI=1S/C24H24FNO3S/c1-3-10-29-24(28)21-14(2)26-18-12-16(20-5-4-11-30-20)13-19(27)23(18)22(21)15-6-8-17(25)9-7-15/h4-9,11,16,22-23,28H,2-3,10,12-13H2,1H3/b24-21-/t16-,22-,23?/m0/s1 |
| InChIKey | VNJFDKGSXDAJTR-UFKHSJGLSA-N |
| XLogP | 5.90 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|