C25H31N3O2 — CID 70132088
ethane;2-[2-(2-hydroxyethyl)piperidin-1-yl]-N-phenylquinoline-4-carboxamide (PubChem CID 70132088) has the molecular formula C25H31N3O2 and a molecular weight of 405.54 g/mol. Its IUPAC name is ethane;2-[2-(2-hydroxyethyl)piperidin-1-yl]-N-phenylquinoline-4-carboxamide.
| Compound Name | ethane;2-[2-(2-hydroxyethyl)piperidin-1-yl]-N-phenylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 70132088 |
| Molecular Formula | C25H31N3O2 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.24 |
| IUPAC Name | ethane;2-[2-(2-hydroxyethyl)piperidin-1-yl]-N-phenylquinoline-4-carboxamide |
| SMILES | CC.O=C(Nc1ccccc1)c1cc(N2CCCCC2CCO)nc2ccccc12 |
| InChI | InChI=1S/C23H25N3O2.C2H6/c27-15-13-18-10-6-7-14-26(18)22-16-20(19-11-4-5-12-21(19)25-22)23(28)24-17-8-2-1-3-9-17;1-2/h1-5,8-9,11-12,16,18,27H,6-7,10,13-15H2,(H,24,28);1-2H3 |
| InChIKey | DQIZOUNVYDGXTO-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |