C20H26N2O3 — CID 110434020
methyl 2-[4-[2-(2-hydroxyethyl)piperidin-1-yl]-2-methylquinolin-3-yl]acetate (PubChem CID 110434020) has the molecular formula C20H26N2O3 and a molecular weight of 342.44 g/mol. Its IUPAC name is methyl 2-[4-[2-(2-hydroxyethyl)piperidin-1-yl]-2-methylquinolin-3-yl]acetate.
| Compound Name | methyl 2-[4-[2-(2-hydroxyethyl)piperidin-1-yl]-2-methylquinolin-3-yl]acetate |
|---|---|
| PubChem CID | 110434020 |
| Molecular Formula | C20H26N2O3 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | methyl 2-[4-[2-(2-hydroxyethyl)piperidin-1-yl]-2-methylquinolin-3-yl]acetate |
| SMILES | COC(=O)Cc1c(C)nc2ccccc2c1N1CCCCC1CCO |
| InChI | InChI=1S/C20H26N2O3/c1-14-17(13-19(24)25-2)20(16-8-3-4-9-18(16)21-14)22-11-6-5-7-15(22)10-12-23/h3-4,8-9,15,23H,5-7,10-13H2,1-2H3 |
| InChIKey | XWXJTYHYPXUISU-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |