C27H43FO2Si — CID 70134468
(2E)-2-[(3S,8R,9S,10R,13S,14S)-3-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14-decahydrocyclopenta[a]phenanthren-17-ylidene]-2-fluoroethanol (PubChem CID 70134468) has the molecular formula C27H43FO2Si and a molecular weight of 446.72 g/mol. Its IUPAC name is (2E)-2-[(3S,8R,9S,10R,13S,14S)-3-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14-decahydrocyclopenta[a]phenanthren-17-ylidene]-2-fluoroethanol.
| Compound Name | (2E)-2-[(3S,8R,9S,10R,13S,14S)-3-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14-decahydrocyclopenta[a]phenanthren-17-ylidene]-2-fluoroethanol |
|---|---|
| PubChem CID | 70134468 |
| Molecular Formula | C27H43FO2Si |
| Molecular Weight | 446.72 g/mol |
| Exact Mass | 446.30 |
| IUPAC Name | (2E)-2-[(3S,8R,9S,10R,13S,14S)-3-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14-decahydrocyclopenta[a]phenanthren-17-ylidene]-2-fluoroethanol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CC[C@@]2(C)C(=CC[C@@H]3[C@@H]2CC[C@]2(C)/C(=C(/F)CO)C=C[C@@H]32)C1 |
| InChI | InChI=1S/C27H43FO2Si/c1-25(2,3)31(6,7)30-19-12-14-26(4)18(16-19)8-9-20-21-10-11-23(24(28)17-29)27(21,5)15-13-22(20)26/h8,10-11,19-22,29H,9,12-17H2,1-7H3/b24-23+/t19-,20-,21-,22-,26-,27-/m0/s1 |
| InChIKey | ORPASHIDPXZIBQ-VIRMDUKQSA-N |
| XLogP | 7.33 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.72 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|