About 2-methoxy-3-phenylbicyclo[3.1.0]hexa-1(6),2,4-triene;1-(2-phenylpiperazin-1-yl)ethanone
2-methoxy-3-phenylbicyclo[3.1.0]hexa-1(6),2,4-triene;1-(2-phenylpiperazin-1-yl)ethanone (PubChem CID 70137134) has the molecular formula C25H26N2O2
and a molecular weight of 386.50 g/mol. Its IUPAC name is 2-methoxy-3-phenylbicyclo[3.1.0]hexa-1(6),2,4-triene;1-(2-phenylpiperazin-1-yl)ethanone.
Molecular Properties
| Compound Name | 2-methoxy-3-phenylbicyclo[3.1.0]hexa-1(6),2,4-triene;1-(2-phenylpiperazin-1-yl)ethanone |
| PubChem CID | 70137134 |
| Molecular Formula | C25H26N2O2 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | 2-methoxy-3-phenylbicyclo[3.1.0]hexa-1(6),2,4-triene;1-(2-phenylpiperazin-1-yl)ethanone |
| SMILES | CC(=O)N1CCNCC1c1ccccc1.COc1c(-c2ccccc2)cc2cc1-2 |
| InChI | InChI=1S/C13H10O.C12H16N2O/c1-14-13-11(7-10-8-12(10)13)9-5-3-2-4-6-9;1-10(15)14-8-7-13-9-12(14)11-5-3-2-4-6-11/h2-8H,1H3;2-6,12-13H,7-9H2,1H3 |
| InChIKey | PGGXNEVMWNQCGO-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methoxy-3-phenylbicyclo[3.1.0]hexa-1(6),2,4-triene;1-(2-phenylpiperazin-1-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-3-phenylbicyclo[3.1.0]hexa-1(6),2,4-triene;1-(2-phenylpiperazin-1-yl)ethanone?
The IUPAC name of 2-methoxy-3-phenylbicyclo[3.1.0]hexa-1(6),2,4-triene;1-(2-phenylpiperazin-1-yl)ethanone (CID 70137134) is 2-methoxy-3-phenylbicyclo[3.1.0]hexa-1(6),2,4-triene;1-(2-phenylpiperazin-1-yl)ethanone.
What is the SMILES notation for 2-methoxy-3-phenylbicyclo[3.1.0]hexa-1(6),2,4-triene;1-(2-phenylpiperazin-1-yl)ethanone?
The canonical SMILES for 2-methoxy-3-phenylbicyclo[3.1.0]hexa-1(6),2,4-triene;1-(2-phenylpiperazin-1-yl)ethanone is CC(=O)N1CCNCC1c1ccccc1.COc1c(-c2ccccc2)cc2cc1-2.
What is the InChIKey of 2-methoxy-3-phenylbicyclo[3.1.0]hexa-1(6),2,4-triene;1-(2-phenylpiperazin-1-yl)ethanone?
The InChIKey is PGGXNEVMWNQCGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10O.C12H16N2O/c1-14-13-11(7-10-8-12(10)13)9-5-3-2-4-6-9;1-10(15)14-8-7-13-9-12(14)11-5-3-2-4-6-11/h2-8H,1H3;2-6,12-13H,7-9H2,1H3.
What are the key properties of 2-methoxy-3-phenylbicyclo[3.1.0]hexa-1(6),2,4-triene;1-(2-phenylpiperazin-1-yl)ethanone?
2-methoxy-3-phenylbicyclo[3.1.0]hexa-1(6),2,4-triene;1-(2-phenylpiperazin-1-yl)ethanone has a molecular weight of 386.50 g/mol, XLogP of 4.52, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-3-phenylbicyclo[3.1.0]hexa-1(6),2,4-triene;1-(2-phenylpiperazin-1-yl)ethanone is sourced from PubChem (CID 70137134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).