C33H28Cl3N3O9 — CID 70137474
2-(4-chloro-2-methylphenoxy)propanoic acid;2-chloro-6-nitro-3-phenoxyaniline;2-(5-chloroquinolin-8-yl)oxyacetic acid (PubChem CID 70137474) has the molecular formula C33H28Cl3N3O9 and a molecular weight of 716.96 g/mol. Its IUPAC name is 2-(4-chloro-2-methylphenoxy)propanoic acid;2-chloro-6-nitro-3-phenoxyaniline;2-(5-chloroquinolin-8-yl)oxyacetic acid.
| Compound Name | 2-(4-chloro-2-methylphenoxy)propanoic acid;2-chloro-6-nitro-3-phenoxyaniline;2-(5-chloroquinolin-8-yl)oxyacetic acid |
|---|---|
| PubChem CID | 70137474 |
| Molecular Formula | C33H28Cl3N3O9 |
| Molecular Weight | 716.96 g/mol |
| Exact Mass | 715.09 |
| IUPAC Name | 2-(4-chloro-2-methylphenoxy)propanoic acid;2-chloro-6-nitro-3-phenoxyaniline;2-(5-chloroquinolin-8-yl)oxyacetic acid |
| SMILES | Cc1cc(Cl)ccc1OC(C)C(=O)O.Nc1c([N+](=O)[O-])ccc(Oc2ccccc2)c1Cl.O=C(O)COc1ccc(Cl)c2cccnc12 |
| InChI | InChI=1S/C12H9ClN2O3.C11H8ClNO3.C10H11ClO3/c13-11-10(18-8-4-2-1-3-5-8)7-6-9(12(11)14)15(16)17;12-8-3-4-9(16-6-10(14)15)11-7(8)2-1-5-13-11;1-6-5-8(11)3-4-9(6)14-7(2)10(12)13/h1-7H,14H2;1-5H,6H2,(H,14,15);3-5,7H,1-2H3,(H,12,13) |
| InChIKey | SAPMXMCPTAGDPT-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 184.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.96 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|