C39H28Cl4FN3O12 — CID 70136661
(2R)-2-[4-[(5-chloro-3-fluoro-2-pyridinyl)oxy]phenoxy]propanoic acid;2-(5-chloroquinolin-8-yl)oxyacetic acid;methyl 5-(2,4-dichlorophenoxy)-2-nitrobenzoate (PubChem CID 70136661) has the molecular formula C39H28Cl4FN3O12 and a molecular weight of 891.47 g/mol. Its IUPAC name is (2R)-2-[4-[(5-chloro-3-fluoro-2-pyridinyl)oxy]phenoxy]propanoic acid;2-(5-chloroquinolin-8-yl)oxyacetic acid;methyl 5-(2,4-dichlorophenoxy)-2-nitrobenzoate.
| Compound Name | (2R)-2-[4-[(5-chloro-3-fluoro-2-pyridinyl)oxy]phenoxy]propanoic acid;2-(5-chloroquinolin-8-yl)oxyacetic acid;methyl 5-(2,4-dichlorophenoxy)-2-nitrobenzoate |
|---|---|
| PubChem CID | 70136661 |
| Molecular Formula | C39H28Cl4FN3O12 |
| Molecular Weight | 891.47 g/mol |
| Exact Mass | 889.04 |
| IUPAC Name | (2R)-2-[4-[(5-chloro-3-fluoro-2-pyridinyl)oxy]phenoxy]propanoic acid;2-(5-chloroquinolin-8-yl)oxyacetic acid;methyl 5-(2,4-dichlorophenoxy)-2-nitrobenzoate |
| SMILES | COC(=O)c1cc(Oc2ccc(Cl)cc2Cl)ccc1[N+](=O)[O-].C[C@@H](Oc1ccc(Oc2ncc(Cl)cc2F)cc1)C(=O)O.O=C(O)COc1ccc(Cl)c2cccnc12 |
| InChI | InChI=1S/C14H9Cl2NO5.C14H11ClFNO4.C11H8ClNO3/c1-21-14(18)10-7-9(3-4-12(10)17(19)20)22-13-5-2-8(15)6-11(13)16;1-8(14(18)19)20-10-2-4-11(5-3-10)21-13-12(16)6-9(15)7-17-13;12-8-3-4-9(16-6-10(14)15)11-7(8)2-1-5-13-11/h2-7H,1H3;2-8H,1H3,(H,18,19);1-5H,6H2,(H,14,15)/t;8-;/m.1./s1 |
| InChIKey | KBCBLXNIPYNMDE-RORZRARGSA-N |
| XLogP | 10.35 |
| TPSA | 206.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 891.47 |
| LogP ≤ 5 | 10.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|