C8H14N2O — CID 70138590
1-(5-amino-3,4-dihydro-2H-pyrrol-3-yl)butan-1-one (PubChem CID 70138590) has the molecular formula C8H14N2O and a molecular weight of 154.21 g/mol. Its IUPAC name is 1-(5-amino-3,4-dihydro-2H-pyrrol-3-yl)butan-1-one.
| Compound Name | 1-(5-amino-3,4-dihydro-2H-pyrrol-3-yl)butan-1-one |
|---|---|
| PubChem CID | 70138590 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | 1-(5-amino-3,4-dihydro-2H-pyrrol-3-yl)butan-1-one |
| SMILES | CCCC(=O)C1CN=C(N)C1 |
| InChI | InChI=1S/C8H14N2O/c1-2-3-7(11)6-4-8(9)10-5-6/h6H,2-5H2,1H3,(H2,9,10) |
| InChIKey | QBNAWOZNCOAGAR-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |