C20H26ClN3O — CID 70138919
3-amino-N-benzyl-2-[2-(4-chlorophenyl)ethyl-ethylamino]propanamide (PubChem CID 70138919) has the molecular formula C20H26ClN3O and a molecular weight of 359.90 g/mol. Its IUPAC name is 3-amino-N-benzyl-2-[2-(4-chlorophenyl)ethyl-ethylamino]propanamide.
| Compound Name | 3-amino-N-benzyl-2-[2-(4-chlorophenyl)ethyl-ethylamino]propanamide |
|---|---|
| PubChem CID | 70138919 |
| Molecular Formula | C20H26ClN3O |
| Molecular Weight | 359.90 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | 3-amino-N-benzyl-2-[2-(4-chlorophenyl)ethyl-ethylamino]propanamide |
| SMILES | CCN(CCc1ccc(Cl)cc1)C(CN)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C20H26ClN3O/c1-2-24(13-12-16-8-10-18(21)11-9-16)19(14-22)20(25)23-15-17-6-4-3-5-7-17/h3-11,19H,2,12-15,22H2,1H3,(H,23,25) |
| InChIKey | MIRUMMGBTSPIMY-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.90 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |