C15H26O5 — CID 70139005
carbonic acid;2-hexyl-3,6-dimethylidenecyclohexane-1,1-diol (PubChem CID 70139005) has the molecular formula C15H26O5 and a molecular weight of 286.37 g/mol. Its IUPAC name is carbonic acid;2-hexyl-3,6-dimethylidenecyclohexane-1,1-diol.
| Compound Name | carbonic acid;2-hexyl-3,6-dimethylidenecyclohexane-1,1-diol |
|---|---|
| PubChem CID | 70139005 |
| Molecular Formula | C15H26O5 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | carbonic acid;2-hexyl-3,6-dimethylidenecyclohexane-1,1-diol |
| SMILES | C=C1CCC(=C)C(O)(O)C1CCCCCC.O=C(O)O |
| InChI | InChI=1S/C14H24O2.CH2O3/c1-4-5-6-7-8-13-11(2)9-10-12(3)14(13,15)16;2-1(3)4/h13,15-16H,2-10H2,1H3;(H2,2,3,4) |
| InChIKey | PEMGRFCHPBLPOJ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|