C12H17Cl2NO — CID 70139050
(2R,4S,6R)-2-(3-chlorophenyl)-6-methylpiperidin-4-ol;hydrochloride (PubChem CID 70139050) has the molecular formula C12H17Cl2NO and a molecular weight of 262.18 g/mol. Its IUPAC name is (2R,4S,6R)-2-(3-chlorophenyl)-6-methylpiperidin-4-ol;hydrochloride.
| Compound Name | (2R,4S,6R)-2-(3-chlorophenyl)-6-methylpiperidin-4-ol;hydrochloride |
|---|---|
| PubChem CID | 70139050 |
| Molecular Formula | C12H17Cl2NO |
| Molecular Weight | 262.18 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | (2R,4S,6R)-2-(3-chlorophenyl)-6-methylpiperidin-4-ol;hydrochloride |
| SMILES | C[C@@H]1C[C@H](O)C[C@H](c2cccc(Cl)c2)N1.Cl |
| InChI | InChI=1S/C12H16ClNO.ClH/c1-8-5-11(15)7-12(14-8)9-3-2-4-10(13)6-9;/h2-4,6,8,11-12,14-15H,5,7H2,1H3;1H/t8-,11+,12-;/m1./s1 |
| InChIKey | YRBFXLQFHQQHFR-XYQDSGAJSA-N |
| XLogP | 2.94 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.18 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |