C14H15F — CID 70140238
1-(3,3-dimethylcyclohexa-1,4-dien-1-yl)-2-fluorobenzene (PubChem CID 70140238) has the molecular formula C14H15F and a molecular weight of 202.27 g/mol. Its IUPAC name is 1-(3,3-dimethylcyclohexa-1,4-dien-1-yl)-2-fluorobenzene.
| Compound Name | 1-(3,3-dimethylcyclohexa-1,4-dien-1-yl)-2-fluorobenzene |
|---|---|
| PubChem CID | 70140238 |
| Molecular Formula | C14H15F |
| Molecular Weight | 202.27 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | 1-(3,3-dimethylcyclohexa-1,4-dien-1-yl)-2-fluorobenzene |
| SMILES | CC1(C)C=CCC(c2ccccc2F)=C1 |
| InChI | InChI=1S/C14H15F/c1-14(2)9-5-6-11(10-14)12-7-3-4-8-13(12)15/h3-5,7-10H,6H2,1-2H3 |
| InChIKey | ULUCHEFAFAPFBY-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.27 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|