C24H32F3N3O3 — CID 70141208
3-[4-[2-oxo-3-[3-(2,2,2-trifluoroethyl)-1,2,4,5-tetrahydro-3-benzazepin-7-yl]imidazolidin-1-yl]cyclohexyl]propanoic acid (PubChem CID 70141208) has the molecular formula C24H32F3N3O3 and a molecular weight of 467.53 g/mol. Its IUPAC name is 3-[4-[2-oxo-3-[3-(2,2,2-trifluoroethyl)-1,2,4,5-tetrahydro-3-benzazepin-7-yl]imidazolidin-1-yl]cyclohexyl]propanoic acid.
| Compound Name | 3-[4-[2-oxo-3-[3-(2,2,2-trifluoroethyl)-1,2,4,5-tetrahydro-3-benzazepin-7-yl]imidazolidin-1-yl]cyclohexyl]propanoic acid |
|---|---|
| PubChem CID | 70141208 |
| Molecular Formula | C24H32F3N3O3 |
| Molecular Weight | 467.53 g/mol |
| Exact Mass | 467.24 |
| IUPAC Name | 3-[4-[2-oxo-3-[3-(2,2,2-trifluoroethyl)-1,2,4,5-tetrahydro-3-benzazepin-7-yl]imidazolidin-1-yl]cyclohexyl]propanoic acid |
| SMILES | O=C(O)CCC1CCC(N2CCN(c3ccc4c(c3)CCN(CC(F)(F)F)CC4)C2=O)CC1 |
| InChI | InChI=1S/C24H32F3N3O3/c25-24(26,27)16-28-11-9-18-4-7-21(15-19(18)10-12-28)30-14-13-29(23(30)33)20-5-1-17(2-6-20)3-8-22(31)32/h4,7,15,17,20H,1-3,5-6,8-14,16H2,(H,31,32) |
| InChIKey | MPARVCVRYXPQET-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.53 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |