C23H32N4O3 — CID 18943413
3-[4-[3-methyl-1-(3-methyl-1,2,4,5-tetrahydro-3-benzazepin-7-yl)-5-oxo-1,2,4-triazol-4-yl]cyclohexyl]propanoic acid (PubChem CID 18943413) has the molecular formula C23H32N4O3 and a molecular weight of 412.53 g/mol. Its IUPAC name is 3-[4-[3-methyl-1-(3-methyl-1,2,4,5-tetrahydro-3-benzazepin-7-yl)-5-oxo-1,2,4-triazol-4-yl]cyclohexyl]propanoic acid.
| Compound Name | 3-[4-[3-methyl-1-(3-methyl-1,2,4,5-tetrahydro-3-benzazepin-7-yl)-5-oxo-1,2,4-triazol-4-yl]cyclohexyl]propanoic acid |
|---|---|
| PubChem CID | 18943413 |
| Molecular Formula | C23H32N4O3 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.25 |
| IUPAC Name | 3-[4-[3-methyl-1-(3-methyl-1,2,4,5-tetrahydro-3-benzazepin-7-yl)-5-oxo-1,2,4-triazol-4-yl]cyclohexyl]propanoic acid |
| SMILES | Cc1nn(-c2ccc3c(c2)CCN(C)CC3)c(=O)n1C1CCC(CCC(=O)O)CC1 |
| InChI | InChI=1S/C23H32N4O3/c1-16-24-27(21-9-6-18-11-13-25(2)14-12-19(18)15-21)23(30)26(16)20-7-3-17(4-8-20)5-10-22(28)29/h6,9,15,17,20H,3-5,7-8,10-14H2,1-2H3,(H,28,29) |
| InChIKey | HCNGLSDWYPCFNY-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 80.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |