C25H31F3N4O4 — CID 18943434
methyl 3-[4-[3-methyl-5-oxo-1-[3-(2,2,2-trifluoroacetyl)-1,2,4,5-tetrahydro-3-benzazepin-7-yl]-1,2,4-triazol-4-yl]cyclohexyl]propanoate (PubChem CID 18943434) has the molecular formula C25H31F3N4O4 and a molecular weight of 508.54 g/mol. Its IUPAC name is methyl 3-[4-[3-methyl-5-oxo-1-[3-(2,2,2-trifluoroacetyl)-1,2,4,5-tetrahydro-3-benzazepin-7-yl]-1,2,4-triazol-4-yl]cyclohexyl]propanoate.
| Compound Name | methyl 3-[4-[3-methyl-5-oxo-1-[3-(2,2,2-trifluoroacetyl)-1,2,4,5-tetrahydro-3-benzazepin-7-yl]-1,2,4-triazol-4-yl]cyclohexyl]propanoate |
|---|---|
| PubChem CID | 18943434 |
| Molecular Formula | C25H31F3N4O4 |
| Molecular Weight | 508.54 g/mol |
| Exact Mass | 508.23 |
| IUPAC Name | methyl 3-[4-[3-methyl-5-oxo-1-[3-(2,2,2-trifluoroacetyl)-1,2,4,5-tetrahydro-3-benzazepin-7-yl]-1,2,4-triazol-4-yl]cyclohexyl]propanoate |
| SMILES | COC(=O)CCC1CCC(n2c(C)nn(-c3ccc4c(c3)CCN(C(=O)C(F)(F)F)CC4)c2=O)CC1 |
| InChI | InChI=1S/C25H31F3N4O4/c1-16-29-32(24(35)31(16)20-7-3-17(4-8-20)5-10-22(33)36-2)21-9-6-18-11-13-30(14-12-19(18)15-21)23(34)25(26,27)28/h6,9,15,17,20H,3-5,7-8,10-14H2,1-2H3 |
| InChIKey | BBQKOOKQSCDCCG-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 86.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.54 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |