C19H22N2O5S2 — CID 70141958
1-(benzenesulfonyl)-N-butyl-6-(hydroxymethyl)indole-2-sulfonamide (PubChem CID 70141958) has the molecular formula C19H22N2O5S2 and a molecular weight of 422.53 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-N-butyl-6-(hydroxymethyl)indole-2-sulfonamide.
| Compound Name | 1-(benzenesulfonyl)-N-butyl-6-(hydroxymethyl)indole-2-sulfonamide |
|---|---|
| PubChem CID | 70141958 |
| Molecular Formula | C19H22N2O5S2 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | 1-(benzenesulfonyl)-N-butyl-6-(hydroxymethyl)indole-2-sulfonamide |
| SMILES | CCCCNS(=O)(=O)c1cc2ccc(CO)cc2n1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C19H22N2O5S2/c1-2-3-11-20-27(23,24)19-13-16-10-9-15(14-22)12-18(16)21(19)28(25,26)17-7-5-4-6-8-17/h4-10,12-13,20,22H,2-3,11,14H2,1H3 |
| InChIKey | VHMKFHJNPZSUGG-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 105.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|