C17H24N2O2 — CID 70143474
2-octyl-5-phenylpyrazolidine-3,4-dione (PubChem CID 70143474) has the molecular formula C17H24N2O2 and a molecular weight of 288.39 g/mol. Its IUPAC name is 2-octyl-5-phenylpyrazolidine-3,4-dione.
| Compound Name | 2-octyl-5-phenylpyrazolidine-3,4-dione |
|---|---|
| PubChem CID | 70143474 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | 2-octyl-5-phenylpyrazolidine-3,4-dione |
| SMILES | CCCCCCCCN1NC(c2ccccc2)C(=O)C1=O |
| InChI | InChI=1S/C17H24N2O2/c1-2-3-4-5-6-10-13-19-17(21)16(20)15(18-19)14-11-8-7-9-12-14/h7-9,11-12,15,18H,2-6,10,13H2,1H3 |
| InChIKey | IQJHTSPUKLDOFR-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|