C14H18N2O6 — CID 70145361
4-amino-2-[ethyl(phenylmethoxycarbonyl)amino]-2-hydroxy-3-oxobutanoic acid (PubChem CID 70145361) has the molecular formula C14H18N2O6 and a molecular weight of 310.31 g/mol. Its IUPAC name is 4-amino-2-[ethyl(phenylmethoxycarbonyl)amino]-2-hydroxy-3-oxobutanoic acid.
| Compound Name | 4-amino-2-[ethyl(phenylmethoxycarbonyl)amino]-2-hydroxy-3-oxobutanoic acid |
|---|---|
| PubChem CID | 70145361 |
| Molecular Formula | C14H18N2O6 |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 4-amino-2-[ethyl(phenylmethoxycarbonyl)amino]-2-hydroxy-3-oxobutanoic acid |
| SMILES | CCN(C(=O)OCc1ccccc1)C(O)(C(=O)O)C(=O)CN |
| InChI | InChI=1S/C14H18N2O6/c1-2-16(14(21,12(18)19)11(17)8-15)13(20)22-9-10-6-4-3-5-7-10/h3-7,21H,2,8-9,15H2,1H3,(H,18,19) |
| InChIKey | RKQLMIZBKYQLKP-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 130.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|