C31H42O9 — CID 70146354
diethyl 2-methyl-2-[2-(2-phenylmethoxyphenyl)ethyl]propanedioate;diethyl 2-methylpropanedioate (PubChem CID 70146354) has the molecular formula C31H42O9 and a molecular weight of 558.67 g/mol. Its IUPAC name is diethyl 2-methyl-2-[2-(2-phenylmethoxyphenyl)ethyl]propanedioate;diethyl 2-methylpropanedioate.
| Compound Name | diethyl 2-methyl-2-[2-(2-phenylmethoxyphenyl)ethyl]propanedioate;diethyl 2-methylpropanedioate |
|---|---|
| PubChem CID | 70146354 |
| Molecular Formula | C31H42O9 |
| Molecular Weight | 558.67 g/mol |
| Exact Mass | 558.28 |
| IUPAC Name | diethyl 2-methyl-2-[2-(2-phenylmethoxyphenyl)ethyl]propanedioate;diethyl 2-methylpropanedioate |
| SMILES | CCOC(=O)C(C)(CCc1ccccc1OCc1ccccc1)C(=O)OCC.CCOC(=O)C(C)C(=O)OCC |
| InChI | InChI=1S/C23H28O5.C8H14O4/c1-4-26-21(24)23(3,22(25)27-5-2)16-15-19-13-9-10-14-20(19)28-17-18-11-7-6-8-12-18;1-4-11-7(9)6(3)8(10)12-5-2/h6-14H,4-5,15-17H2,1-3H3;6H,4-5H2,1-3H3 |
| InChIKey | HFGNOTHYZTWZKY-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.67 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|