C22H22BrFN2O4 — CID 70146695
N-[[(5S)-3-[4-[2-(4-acetylphenyl)-2-bromoethyl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide (PubChem CID 70146695) has the molecular formula C22H22BrFN2O4 and a molecular weight of 477.33 g/mol. Its IUPAC name is N-[[(5S)-3-[4-[2-(4-acetylphenyl)-2-bromoethyl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide.
| Compound Name | N-[[(5S)-3-[4-[2-(4-acetylphenyl)-2-bromoethyl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 70146695 |
| Molecular Formula | C22H22BrFN2O4 |
| Molecular Weight | 477.33 g/mol |
| Exact Mass | 476.07 |
| IUPAC Name | N-[[(5S)-3-[4-[2-(4-acetylphenyl)-2-bromoethyl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
| SMILES | CC(=O)NC[C@H]1CN(c2ccc(CC(Br)c3ccc(C(C)=O)cc3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C22H22BrFN2O4/c1-13(27)15-3-5-16(6-4-15)20(23)9-17-7-8-18(10-21(17)24)26-12-19(30-22(26)29)11-25-14(2)28/h3-8,10,19-20H,9,11-12H2,1-2H3,(H,25,28)/t19-,20?/m0/s1 |
| InChIKey | MVHJNHDCQQFMCM-XJDOXCRVSA-N |
| XLogP | 4.17 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.33 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|