C22H34N4O2 — CID 70148156
1-(2,6-dimethylphenoxy)propan-2-amine;1-[(4-methoxyphenyl)methyl]-2,3-dimethylguanidine (PubChem CID 70148156) has the molecular formula C22H34N4O2 and a molecular weight of 386.54 g/mol. Its IUPAC name is 1-(2,6-dimethylphenoxy)propan-2-amine;1-[(4-methoxyphenyl)methyl]-2,3-dimethylguanidine.
| Compound Name | 1-(2,6-dimethylphenoxy)propan-2-amine;1-[(4-methoxyphenyl)methyl]-2,3-dimethylguanidine |
|---|---|
| PubChem CID | 70148156 |
| Molecular Formula | C22H34N4O2 |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.27 |
| IUPAC Name | 1-(2,6-dimethylphenoxy)propan-2-amine;1-[(4-methoxyphenyl)methyl]-2,3-dimethylguanidine |
| SMILES | C/N=C(\NC)NCc1ccc(OC)cc1.Cc1cccc(C)c1OCC(C)N |
| InChI | InChI=1S/C11H17N3O.C11H17NO/c1-12-11(13-2)14-8-9-4-6-10(15-3)7-5-9;1-8-5-4-6-9(2)11(8)13-7-10(3)12/h4-7H,8H2,1-3H3,(H2,12,13,14);4-6,10H,7,12H2,1-3H3 |
| InChIKey | RPRCAIAQKISAMD-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|